C13H23ClO — CID 77051551
3-(4-chlorobut-2-enoxy)-1,1,5-trimethylcyclohexane (PubChem CID 77051551) has the molecular formula C13H23ClO and a molecular weight of 230.78 g/mol. Its IUPAC name is 3-(4-chlorobut-2-enoxy)-1,1,5-trimethylcyclohexane.
| Compound Name | 3-(4-chlorobut-2-enoxy)-1,1,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 77051551 |
| Molecular Formula | C13H23ClO |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-(4-chlorobut-2-enoxy)-1,1,5-trimethylcyclohexane |
| SMILES | CC1CC(OCC=CCCl)CC(C)(C)C1 |
| InChI | InChI=1S/C13H23ClO/c1-11-8-12(10-13(2,3)9-11)15-7-5-4-6-14/h4-5,11-12H,6-10H2,1-3H3 |
| InChIKey | DXWFHHGGYNAIIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|