About 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine
1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine (PubChem CID 77051843) has the molecular formula C11H20ClN
and a molecular weight of 201.74 g/mol. Its IUPAC name is 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine |
| PubChem CID | 77051843 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine |
| SMILES | CC1CCCC(C)N1CC=CCCl |
| InChI | InChI=1S/C11H20ClN/c1-10-6-5-7-11(2)13(10)9-4-3-8-12/h3-4,10-11H,5-9H2,1-2H3 |
| InChIKey | BPGNBPPQALYJQG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine?
The IUPAC name of 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine (CID 77051843) is 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine.
What is the SMILES notation for 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine?
The canonical SMILES for 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine is CC1CCCC(C)N1CC=CCCl.
What is the InChIKey of 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine?
The InChIKey is BPGNBPPQALYJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20ClN/c1-10-6-5-7-11(2)13(10)9-4-3-8-12/h3-4,10-11H,5-9H2,1-2H3.
What are the key properties of 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine?
1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine has a molecular weight of 201.74 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorobut-2-enyl)-2,6-dimethylpiperidine is sourced from PubChem (CID 77051843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).