About 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide
2-amino-2-cyclopropyl-N'-hydroxyethanimidamide (PubChem CID 77052245) has the molecular formula C5H11N3O
and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide |
| PubChem CID | 77052245 |
| Molecular Formula | C5H11N3O |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide |
| SMILES | NC(=NO)C(N)C1CC1 |
| InChI | InChI=1S/C5H11N3O/c6-4(3-1-2-3)5(7)8-9/h3-4,9H,1-2,6H2,(H2,7,8) |
| InChIKey | XPPVHDNDFCJYRX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide?
The IUPAC name of 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide (CID 77052245) is 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide?
The canonical SMILES for 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide is NC(=NO)C(N)C1CC1.
What is the InChIKey of 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide?
The InChIKey is XPPVHDNDFCJYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O/c6-4(3-1-2-3)5(7)8-9/h3-4,9H,1-2,6H2,(H2,7,8).
What are the key properties of 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide?
2-amino-2-cyclopropyl-N'-hydroxyethanimidamide has a molecular weight of 129.16 g/mol, XLogP of -0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-cyclopropyl-N'-hydroxyethanimidamide is sourced from PubChem (CID 77052245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).