C18H25BrO — CID 77052674
1-(bromomethyl)-1-[(2-prop-1-enylphenoxy)methyl]cycloheptane (PubChem CID 77052674) has the molecular formula C18H25BrO and a molecular weight of 337.30 g/mol. Its IUPAC name is 1-(bromomethyl)-1-[(2-prop-1-enylphenoxy)methyl]cycloheptane.
| Compound Name | 1-(bromomethyl)-1-[(2-prop-1-enylphenoxy)methyl]cycloheptane |
|---|---|
| PubChem CID | 77052674 |
| Molecular Formula | C18H25BrO |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(bromomethyl)-1-[(2-prop-1-enylphenoxy)methyl]cycloheptane |
| SMILES | CC=Cc1ccccc1OCC1(CBr)CCCCCC1 |
| InChI | InChI=1S/C18H25BrO/c1-2-9-16-10-5-6-11-17(16)20-15-18(14-19)12-7-3-4-8-13-18/h2,5-6,9-11H,3-4,7-8,12-15H2,1H3 |
| InChIKey | ITGTVBGXTFODJB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|