About N'-amino-2,6-dimethylmorpholine-4-carboximidamide
N'-amino-2,6-dimethylmorpholine-4-carboximidamide (PubChem CID 77053849) has the molecular formula C7H16N4O
and a molecular weight of 172.23 g/mol. Its IUPAC name is N'-amino-2,6-dimethylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-amino-2,6-dimethylmorpholine-4-carboximidamide |
| PubChem CID | 77053849 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | N'-amino-2,6-dimethylmorpholine-4-carboximidamide |
| SMILES | CC1CN(C(N)=NN)CC(C)O1 |
| InChI | InChI=1S/C7H16N4O/c1-5-3-11(7(8)10-9)4-6(2)12-5/h5-6H,3-4,9H2,1-2H3,(H2,8,10) |
| InChIKey | ALCBXJIZMQJIFG-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-2,6-dimethylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-2,6-dimethylmorpholine-4-carboximidamide?
The IUPAC name of N'-amino-2,6-dimethylmorpholine-4-carboximidamide (CID 77053849) is N'-amino-2,6-dimethylmorpholine-4-carboximidamide.
What is the SMILES notation for N'-amino-2,6-dimethylmorpholine-4-carboximidamide?
The canonical SMILES for N'-amino-2,6-dimethylmorpholine-4-carboximidamide is CC1CN(C(N)=NN)CC(C)O1.
What is the InChIKey of N'-amino-2,6-dimethylmorpholine-4-carboximidamide?
The InChIKey is ALCBXJIZMQJIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N4O/c1-5-3-11(7(8)10-9)4-6(2)12-5/h5-6H,3-4,9H2,1-2H3,(H2,8,10).
What are the key properties of N'-amino-2,6-dimethylmorpholine-4-carboximidamide?
N'-amino-2,6-dimethylmorpholine-4-carboximidamide has a molecular weight of 172.23 g/mol, XLogP of -0.72, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-2,6-dimethylmorpholine-4-carboximidamide is sourced from PubChem (CID 77053849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).