About 2-amino-1,1-bis(2-methylpropyl)guanidine
2-amino-1,1-bis(2-methylpropyl)guanidine (PubChem CID 77053901) has the molecular formula C9H22N4
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-amino-1,1-bis(2-methylpropyl)guanidine.
Molecular Properties
| Compound Name | 2-amino-1,1-bis(2-methylpropyl)guanidine |
| PubChem CID | 77053901 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 2-amino-1,1-bis(2-methylpropyl)guanidine |
| SMILES | CC(C)CN(CC(C)C)C(N)=NN |
| InChI | InChI=1S/C9H22N4/c1-7(2)5-13(6-8(3)4)9(10)12-11/h7-8H,5-6,11H2,1-4H3,(H2,10,12) |
| InChIKey | WPBVUBCRMDQWMP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,1-bis(2-methylpropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,1-bis(2-methylpropyl)guanidine?
The IUPAC name of 2-amino-1,1-bis(2-methylpropyl)guanidine (CID 77053901) is 2-amino-1,1-bis(2-methylpropyl)guanidine.
What is the SMILES notation for 2-amino-1,1-bis(2-methylpropyl)guanidine?
The canonical SMILES for 2-amino-1,1-bis(2-methylpropyl)guanidine is CC(C)CN(CC(C)C)C(N)=NN.
What is the InChIKey of 2-amino-1,1-bis(2-methylpropyl)guanidine?
The InChIKey is WPBVUBCRMDQWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N4/c1-7(2)5-13(6-8(3)4)9(10)12-11/h7-8H,5-6,11H2,1-4H3,(H2,10,12).
What are the key properties of 2-amino-1,1-bis(2-methylpropyl)guanidine?
2-amino-1,1-bis(2-methylpropyl)guanidine has a molecular weight of 186.30 g/mol, XLogP of 0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,1-bis(2-methylpropyl)guanidine is sourced from PubChem (CID 77053901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).