C9H13BrN4 — CID 77053986
2-amino-1-[(4-bromophenyl)methyl]-1-methylguanidine (PubChem CID 77053986) has the molecular formula C9H13BrN4 and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-amino-1-[(4-bromophenyl)methyl]-1-methylguanidine.
| Compound Name | 2-amino-1-[(4-bromophenyl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 77053986 |
| Molecular Formula | C9H13BrN4 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-amino-1-[(4-bromophenyl)methyl]-1-methylguanidine |
| SMILES | CN(Cc1ccc(Br)cc1)C(N)=NN |
| InChI | InChI=1S/C9H13BrN4/c1-14(9(11)13-12)6-7-2-4-8(10)5-3-7/h2-5H,6,12H2,1H3,(H2,11,13) |
| InChIKey | ZXLUMYHAZCSYQW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|