About 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide
3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide (PubChem CID 77054274) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide |
| PubChem CID | 77054274 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide |
| SMILES | CC1CC(C)CC(N(C)CCC(N)=NO)C1 |
| InChI | InChI=1S/C12H25N3O/c1-9-6-10(2)8-11(7-9)15(3)5-4-12(13)14-16/h9-11,16H,4-8H2,1-3H3,(H2,13,14) |
| InChIKey | VGVHOJCDDTVZSD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide?
The IUPAC name of 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide (CID 77054274) is 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide?
The canonical SMILES for 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide is CC1CC(C)CC(N(C)CCC(N)=NO)C1.
What is the InChIKey of 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide?
The InChIKey is VGVHOJCDDTVZSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O/c1-9-6-10(2)8-11(7-9)15(3)5-4-12(13)14-16/h9-11,16H,4-8H2,1-3H3,(H2,13,14).
What are the key properties of 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide?
3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide has a molecular weight of 227.35 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethylcyclohexyl)-methylamino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 77054274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).