About 1-[3,5-bis(trifluoromethyl)phenyl]piperazine
1-[3,5-bis(trifluoromethyl)phenyl]piperazine (PubChem CID 770558) has the molecular formula C12H12F6N2
and a molecular weight of 298.23 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]piperazine.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]piperazine |
| PubChem CID | 770558 |
| Molecular Formula | C12H12F6N2 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cc(N2CCNCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6N2/c13-11(14,15)8-5-9(12(16,17)18)7-10(6-8)20-3-1-19-2-4-20/h5-7,19H,1-4H2 |
| InChIKey | KBJABLNQZCSKGE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]piperazine?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]piperazine (CID 770558) is 1-[3,5-bis(trifluoromethyl)phenyl]piperazine.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]piperazine?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]piperazine is FC(F)(F)c1cc(N2CCNCC2)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]piperazine?
The InChIKey is KBJABLNQZCSKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6N2/c13-11(14,15)8-5-9(12(16,17)18)7-10(6-8)20-3-1-19-2-4-20/h5-7,19H,1-4H2.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]piperazine?
1-[3,5-bis(trifluoromethyl)phenyl]piperazine has a molecular weight of 298.23 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]piperazine is sourced from PubChem (CID 770558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).