About 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide
2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide (PubChem CID 77056293) has the molecular formula C10H23N3O2
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide |
| PubChem CID | 77056293 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CCC(NCC(O)(CC)CC)C(N)=NO |
| InChI | InChI=1S/C10H23N3O2/c1-4-8(9(11)13-15)12-7-10(14,5-2)6-3/h8,12,14-15H,4-7H2,1-3H3,(H2,11,13) |
| InChIKey | YVACMXHDMCIRPE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide?
The IUPAC name of 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide (CID 77056293) is 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide?
The canonical SMILES for 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide is CCC(NCC(O)(CC)CC)C(N)=NO.
What is the InChIKey of 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide?
The InChIKey is YVACMXHDMCIRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O2/c1-4-8(9(11)13-15)12-7-10(14,5-2)6-3/h8,12,14-15H,4-7H2,1-3H3,(H2,11,13).
What are the key properties of 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide?
2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide has a molecular weight of 217.31 g/mol, XLogP of 0.65, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-2-hydroxybutyl)amino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 77056293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).