C16H20N2O2 — CID 77056496
3-(4-cyanophenyl)-N-(2-ethyl-2-hydroxybutyl)prop-2-enamide (PubChem CID 77056496) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-(2-ethyl-2-hydroxybutyl)prop-2-enamide.
| Compound Name | 3-(4-cyanophenyl)-N-(2-ethyl-2-hydroxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 77056496 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-(4-cyanophenyl)-N-(2-ethyl-2-hydroxybutyl)prop-2-enamide |
| SMILES | CCC(O)(CC)CNC(=O)C=Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-16(20,4-2)12-18-15(19)10-9-13-5-7-14(11-17)8-6-13/h5-10,20H,3-4,12H2,1-2H3,(H,18,19) |
| InChIKey | XDPPHJLBXHCKDA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|