C15H25NO4 — CID 77056626
4-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 77056626) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77056626 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NCC1(O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H25NO4/c1-10(11(2)13(18)19)12(17)16-9-15(20)7-5-14(3,4)6-8-15/h20H,5-9H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | DKSGGHHMRPYVEH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|