About 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide
4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide (PubChem CID 77056811) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide |
| PubChem CID | 77056811 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide |
| SMILES | CCC1CCC(O)(CNCCCC(N)=NO)CC1 |
| InChI | InChI=1S/C13H27N3O2/c1-2-11-5-7-13(17,8-6-11)10-15-9-3-4-12(14)16-18/h11,15,17-18H,2-10H2,1H3,(H2,14,16) |
| InChIKey | CZVOYPIAISMBAI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide?
The IUPAC name of 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide (CID 77056811) is 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide?
The canonical SMILES for 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide is CCC1CCC(O)(CNCCCC(N)=NO)CC1.
What is the InChIKey of 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide?
The InChIKey is CZVOYPIAISMBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-2-11-5-7-13(17,8-6-11)10-15-9-3-4-12(14)16-18/h11,15,17-18H,2-10H2,1H3,(H2,14,16).
What are the key properties of 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide?
4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide has a molecular weight of 257.38 g/mol, XLogP of 1.43, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethyl-1-hydroxycyclohexyl)methylamino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 77056811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).