About N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide
N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide (PubChem CID 77056858) has the molecular formula C14H29N3O2
and a molecular weight of 271.40 g/mol. Its IUPAC name is N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide |
| PubChem CID | 77056858 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide |
| SMILES | CC1(C)CCC(O)(CNCCCCC(N)=NO)CC1 |
| InChI | InChI=1S/C14H29N3O2/c1-13(2)6-8-14(18,9-7-13)11-16-10-4-3-5-12(15)17-19/h16,18-19H,3-11H2,1-2H3,(H2,15,17) |
| InChIKey | HHIOWRHDHVRIFC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide?
The IUPAC name of N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide (CID 77056858) is N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide.
What is the SMILES notation for N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide?
The canonical SMILES for N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide is CC1(C)CCC(O)(CNCCCCC(N)=NO)CC1.
What is the InChIKey of N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide?
The InChIKey is HHIOWRHDHVRIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O2/c1-13(2)6-8-14(18,9-7-13)11-16-10-4-3-5-12(15)17-19/h16,18-19H,3-11H2,1-2H3,(H2,15,17).
What are the key properties of N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide?
N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide has a molecular weight of 271.40 g/mol, XLogP of 1.82, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-5-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]pentanimidamide is sourced from PubChem (CID 77056858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).