C14H27N3O3 — CID 77057718
N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide (PubChem CID 77057718) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide |
|---|---|
| PubChem CID | 77057718 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)N(CCC(N)=NO)C(C)C)C1C |
| InChI | InChI=1S/C14H27N3O3/c1-8(2)17(7-6-12(15)16-19)14(18)13-9(3)10(4)20-11(13)5/h8-11,13,19H,6-7H2,1-5H3,(H2,15,16) |
| InChIKey | OVYUJKXYPKYYIY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|