About N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide
N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide (PubChem CID 77059137) has the molecular formula C8H16F2N2O2S
and a molecular weight of 242.29 g/mol. Its IUPAC name is N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide |
| PubChem CID | 77059137 |
| Molecular Formula | C8H16F2N2O2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H16F2N2O2S/c1-15(13,14)11-4-7-12-5-2-8(9,10)3-6-12/h11H,2-7H2,1H3 |
| InChIKey | FTDWNKJNZYSISD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide?
The IUPAC name of N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide (CID 77059137) is N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide?
The canonical SMILES for N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide is CS(=O)(=O)NCCN1CCC(F)(F)CC1.
What is the InChIKey of N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide?
The InChIKey is FTDWNKJNZYSISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O2S/c1-15(13,14)11-4-7-12-5-2-8(9,10)3-6-12/h11H,2-7H2,1H3.
What are the key properties of N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide?
N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide has a molecular weight of 242.29 g/mol, XLogP of 0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,4-difluoropiperidin-1-yl)ethyl]methanesulfonamide is sourced from PubChem (CID 77059137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).