C11H13N5OS — CID 77059912
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate (PubChem CID 77059912) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77059912 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate |
| SMILES | Cc1ccc2nc(CSC(N)=NN)cc(=O)n2c1 |
| InChI | InChI=1S/C11H13N5OS/c1-7-2-3-9-14-8(6-18-11(12)15-13)4-10(17)16(9)5-7/h2-5H,6,13H2,1H3,(H2,12,15) |
| InChIKey | OVDPNNBDERMTMX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|