C8H15N5OS — CID 77060026
[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl N'-aminocarbamimidothioate (PubChem CID 77060026) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is [5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl N'-aminocarbamimidothioate.
| Compound Name | [5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77060026 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | [5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]methyl N'-aminocarbamimidothioate |
| SMILES | CC(C)Cc1nc(CSC(N)=NN)no1 |
| InChI | InChI=1S/C8H15N5OS/c1-5(2)3-7-11-6(13-14-7)4-15-8(9)12-10/h5H,3-4,10H2,1-2H3,(H2,9,12) |
| InChIKey | CGGAJEWTBUVRKH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|