C8H13N5O2S — CID 77060452
N-(4-amino-4-hydroxyiminobutan-2-yl)-N-methylthiadiazole-5-carboxamide (PubChem CID 77060452) has the molecular formula C8H13N5O2S and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(4-amino-4-hydroxyiminobutan-2-yl)-N-methylthiadiazole-5-carboxamide.
| Compound Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-N-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 77060452 |
| Molecular Formula | C8H13N5O2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-N-methylthiadiazole-5-carboxamide |
| SMILES | CC(CC(N)=NO)N(C)C(=O)c1cnns1 |
| InChI | InChI=1S/C8H13N5O2S/c1-5(3-7(9)11-15)13(2)8(14)6-4-10-12-16-6/h4-5,15H,3H2,1-2H3,(H2,9,11) |
| InChIKey | OXBLHTOSEFWVHI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|