About [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate
[2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate (PubChem CID 77060647) has the molecular formula C11H16N4OS
and a molecular weight of 252.34 g/mol. Its IUPAC name is [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate |
| PubChem CID | 77060647 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate |
| SMILES | CN(Cc1ccccc1)C(=O)CSC(N)=NN |
| InChI | InChI=1S/C11H16N4OS/c1-15(7-9-5-3-2-4-6-9)10(16)8-17-11(12)14-13/h2-6H,7-8,13H2,1H3,(H2,12,14) |
| InChIKey | NZOVRFWEOMYFJG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate?
The IUPAC name of [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate (CID 77060647) is [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate.
What is the SMILES notation for [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate?
The canonical SMILES for [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate is CN(Cc1ccccc1)C(=O)CSC(N)=NN.
What is the InChIKey of [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate?
The InChIKey is NZOVRFWEOMYFJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4OS/c1-15(7-9-5-3-2-4-6-9)10(16)8-17-11(12)14-13/h2-6H,7-8,13H2,1H3,(H2,12,14).
What are the key properties of [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate?
[2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate has a molecular weight of 252.34 g/mol, XLogP of 0.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[benzyl(methyl)amino]-2-oxoethyl] N'-aminocarbamimidothioate is sourced from PubChem (CID 77060647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).