About (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate
(2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate (PubChem CID 77060694) has the molecular formula C12H13ClN4S
and a molecular weight of 280.78 g/mol. Its IUPAC name is (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate |
| PubChem CID | 77060694 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate |
| SMILES | Cc1ccc2cc(CSC(N)=NN)c(Cl)nc2c1 |
| InChI | InChI=1S/C12H13ClN4S/c1-7-2-3-8-5-9(6-18-12(14)17-15)11(13)16-10(8)4-7/h2-5H,6,15H2,1H3,(H2,14,17) |
| InChIKey | BQYXKGBDSNJQCN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate?
The IUPAC name of (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate (CID 77060694) is (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate.
What is the SMILES notation for (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate?
The canonical SMILES for (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate is Cc1ccc2cc(CSC(N)=NN)c(Cl)nc2c1.
What is the InChIKey of (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate?
The InChIKey is BQYXKGBDSNJQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN4S/c1-7-2-3-8-5-9(6-18-12(14)17-15)11(13)16-10(8)4-7/h2-5H,6,15H2,1H3,(H2,14,17).
What are the key properties of (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate?
(2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate has a molecular weight of 280.78 g/mol, XLogP of 2.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-7-methylquinolin-3-yl)methyl N'-aminocarbamimidothioate is sourced from PubChem (CID 77060694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).