About (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate
(2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate (PubChem CID 77060696) has the molecular formula C5H8N4O2S
and a molecular weight of 188.21 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate |
| PubChem CID | 77060696 |
| Molecular Formula | C5H8N4O2S |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SC1CC(=O)NC1=O |
| InChI | InChI=1S/C5H8N4O2S/c6-5(9-7)12-2-1-3(10)8-4(2)11/h2H,1,7H2,(H2,6,9)(H,8,10,11) |
| InChIKey | JWGYEYFAEJSHMP-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate?
The IUPAC name of (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate (CID 77060696) is (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate.
What is the SMILES notation for (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate?
The canonical SMILES for (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate is NN=C(N)SC1CC(=O)NC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate?
The InChIKey is JWGYEYFAEJSHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2S/c6-5(9-7)12-2-1-3(10)8-4(2)11/h2H,1,7H2,(H2,6,9)(H,8,10,11).
What are the key properties of (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate?
(2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate has a molecular weight of 188.21 g/mol, XLogP of -1.68, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-3-yl) N'-aminocarbamimidothioate is sourced from PubChem (CID 77060696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).