About (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate
(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate (PubChem CID 77060718) has the molecular formula C10H14N6S
and a molecular weight of 250.33 g/mol. Its IUPAC name is (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate |
| PubChem CID | 77060718 |
| Molecular Formula | C10H14N6S |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate |
| SMILES | Cc1cc(C)n2cc(CSC(N)=NN)nc2n1 |
| InChI | InChI=1S/C10H14N6S/c1-6-3-7(2)16-4-8(14-10(16)13-6)5-17-9(11)15-12/h3-4H,5,12H2,1-2H3,(H2,11,15) |
| InChIKey | RPBVDPWGEWJAAI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate?
The IUPAC name of (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate (CID 77060718) is (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate.
What is the SMILES notation for (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate?
The canonical SMILES for (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate is Cc1cc(C)n2cc(CSC(N)=NN)nc2n1.
What is the InChIKey of (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate?
The InChIKey is RPBVDPWGEWJAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6S/c1-6-3-7(2)16-4-8(14-10(16)13-6)5-17-9(11)15-12/h3-4H,5,12H2,1-2H3,(H2,11,15).
What are the key properties of (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate?
(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate has a molecular weight of 250.33 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl N'-aminocarbamimidothioate is sourced from PubChem (CID 77060718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).