About 2-hydroxypropyl N'-aminocarbamimidothioate
2-hydroxypropyl N'-aminocarbamimidothioate (PubChem CID 77060896) has the molecular formula C4H11N3OS
and a molecular weight of 149.22 g/mol. Its IUPAC name is 2-hydroxypropyl N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | 2-hydroxypropyl N'-aminocarbamimidothioate |
| PubChem CID | 77060896 |
| Molecular Formula | C4H11N3OS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 2-hydroxypropyl N'-aminocarbamimidothioate |
| SMILES | CC(O)CSC(N)=NN |
| InChI | InChI=1S/C4H11N3OS/c1-3(8)2-9-4(5)7-6/h3,8H,2,6H2,1H3,(H2,5,7) |
| InChIKey | OPGBWOJBYMOBIL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl N'-aminocarbamimidothioate?
The IUPAC name of 2-hydroxypropyl N'-aminocarbamimidothioate (CID 77060896) is 2-hydroxypropyl N'-aminocarbamimidothioate.
What is the SMILES notation for 2-hydroxypropyl N'-aminocarbamimidothioate?
The canonical SMILES for 2-hydroxypropyl N'-aminocarbamimidothioate is CC(O)CSC(N)=NN.
What is the InChIKey of 2-hydroxypropyl N'-aminocarbamimidothioate?
The InChIKey is OPGBWOJBYMOBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3OS/c1-3(8)2-9-4(5)7-6/h3,8H,2,6H2,1H3,(H2,5,7).
What are the key properties of 2-hydroxypropyl N'-aminocarbamimidothioate?
2-hydroxypropyl N'-aminocarbamimidothioate has a molecular weight of 149.22 g/mol, XLogP of -0.71, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl N'-aminocarbamimidothioate is sourced from PubChem (CID 77060896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).