About [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate (PubChem CID 77060998) has the molecular formula C6H10N4O3S
and a molecular weight of 218.24 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate |
| PubChem CID | 77060998 |
| Molecular Formula | C6H10N4O3S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C6H10N4O3S/c7-5(9-8)14-3-4(11)10-1-2-13-6(10)12/h1-3,8H2,(H2,7,9) |
| InChIKey | LUZAVKNILRPCCY-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate?
The IUPAC name of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate (CID 77060998) is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate.
What is the SMILES notation for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate?
The canonical SMILES for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate is NN=C(N)SCC(=O)N1CCOC1=O.
What is the InChIKey of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate?
The InChIKey is LUZAVKNILRPCCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O3S/c7-5(9-8)14-3-4(11)10-1-2-13-6(10)12/h1-3,8H2,(H2,7,9).
What are the key properties of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate?
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate has a molecular weight of 218.24 g/mol, XLogP of -1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] N'-aminocarbamimidothioate is sourced from PubChem (CID 77060998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).