C13H14ClN3O3S — CID 77061185
2-[[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]methyl]butanoic acid (PubChem CID 77061185) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 2-[[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]methyl]butanoic acid.
| Compound Name | 2-[[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 77061185 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-[[3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoylamino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)C=Cc1c(Cl)nc2sccn12)C(=O)O |
| InChI | InChI=1S/C13H14ClN3O3S/c1-2-8(12(19)20)7-15-10(18)4-3-9-11(14)16-13-17(9)5-6-21-13/h3-6,8H,2,7H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | VPJDERUWASQJPL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|