2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid

C14H18N2O3 — CID 77061382

IUPAC2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid
SMILESCCC(CNC(=O)C1Cc2ccccc2N1)C(=O)O
InChIInChI=1S/C14H18N2O3/c1-2-9(14(18)19)8-15-13(17)12-7-10-5-3-4-6-11(10)16-12/h3-6,9,12,16H,2,7-8H2,1H3,(H,15,17)(H,18,19)
InChIKeyAVAXLUDOLDBCMG-UHFFFAOYSA-N
MW262.31 g/mol
LogP1.25
Rot. Bonds5

About 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid

2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid (PubChem CID 77061382) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid.

Molecular Properties

Compound Name2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid
PubChem CID77061382
Molecular FormulaC14H18N2O3
Molecular Weight262.31 g/mol
Exact Mass262.13
IUPAC Name2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid
SMILESCCC(CNC(=O)C1Cc2ccccc2N1)C(=O)O
InChIInChI=1S/C14H18N2O3/c1-2-9(14(18)19)8-15-13(17)12-7-10-5-3-4-6-11(10)16-12/h3-6,9,12,16H,2,7-8H2,1H3,(H,15,17)(H,18,19)
InChIKeyAVAXLUDOLDBCMG-UHFFFAOYSA-N
XLogP1.25
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 51.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid?
The IUPAC name of 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid (CID 77061382) is 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid.
What is the SMILES notation for 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid?
The canonical SMILES for 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid is CCC(CNC(=O)C1Cc2ccccc2N1)C(=O)O.
What is the InChIKey of 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid?
The InChIKey is AVAXLUDOLDBCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-2-9(14(18)19)8-15-13(17)12-7-10-5-3-4-6-11(10)16-12/h3-6,9,12,16H,2,7-8H2,1H3,(H,15,17)(H,18,19).
What are the key properties of 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid?
2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid has a molecular weight of 262.31 g/mol, XLogP of 1.25, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dihydro-1H-indole-2-carbonylamino)methyl]butanoic acid is sourced from PubChem (CID 77061382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).