About 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide
3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide (PubChem CID 77061647) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide |
| PubChem CID | 77061647 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide |
| SMILES | Cc1cc(CNCCC(N)=NO)sc1C |
| InChI | InChI=1S/C10H17N3OS/c1-7-5-9(15-8(7)2)6-12-4-3-10(11)13-14/h5,12,14H,3-4,6H2,1-2H3,(H2,11,13) |
| InChIKey | JIKTUSLQOQJLCX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide?
The IUPAC name of 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide (CID 77061647) is 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide?
The canonical SMILES for 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide is Cc1cc(CNCCC(N)=NO)sc1C.
What is the InChIKey of 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide?
The InChIKey is JIKTUSLQOQJLCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS/c1-7-5-9(15-8(7)2)6-12-4-3-10(11)13-14/h5,12,14H,3-4,6H2,1-2H3,(H2,11,13).
What are the key properties of 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide?
3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide has a molecular weight of 227.33 g/mol, XLogP of 1.59, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dimethylthiophen-2-yl)methylamino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 77061647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).