About 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide
4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77061661) has the molecular formula C15H18FN3OS
and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 77061661 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1cc(CNCc2ccc(C(N)=NO)cc2F)sc1C |
| InChI | InChI=1S/C15H18FN3OS/c1-9-5-13(21-10(9)2)8-18-7-12-4-3-11(6-14(12)16)15(17)19-20/h3-6,18,20H,7-8H2,1-2H3,(H2,17,19) |
| InChIKey | ZQFBJOFYTMNFAE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide (CID 77061661) is 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide is Cc1cc(CNCc2ccc(C(N)=NO)cc2F)sc1C.
What is the InChIKey of 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide?
The InChIKey is ZQFBJOFYTMNFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3OS/c1-9-5-13(21-10(9)2)8-18-7-12-4-3-11(6-14(12)16)15(17)19-20/h3-6,18,20H,7-8H2,1-2H3,(H2,17,19).
What are the key properties of 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide?
4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide has a molecular weight of 307.39 g/mol, XLogP of 2.89, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4,5-dimethylthiophen-2-yl)methylamino]methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 77061661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).