About 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide
4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77061778) has the molecular formula C13H20FN3O
and a molecular weight of 253.32 g/mol. Its IUPAC name is 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| PubChem CID | 77061778 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CN(CCC(C)(C)C(N)=NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FN3O/c1-13(2,12(15)16-18)8-9-17(3)11-6-4-10(14)5-7-11/h4-7,18H,8-9H2,1-3H3,(H2,15,16) |
| InChIKey | MRHISMBYSQYUCD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide?
The IUPAC name of 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide (CID 77061778) is 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide is CN(CCC(C)(C)C(N)=NO)c1ccc(F)cc1.
What is the InChIKey of 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide?
The InChIKey is MRHISMBYSQYUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FN3O/c1-13(2,12(15)16-18)8-9-17(3)11-6-4-10(14)5-7-11/h4-7,18H,8-9H2,1-3H3,(H2,15,16).
What are the key properties of 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide?
4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide has a molecular weight of 253.32 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluoro-N-methylanilino)-N'-hydroxy-2,2-dimethylbutanimidamide is sourced from PubChem (CID 77061778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).