About N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide
N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 77061932) has the molecular formula C11H23N3O2
and a molecular weight of 229.32 g/mol. Its IUPAC name is N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide |
| PubChem CID | 77061932 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCN1CCCC(O)C1)C(N)=NO |
| InChI | InChI=1S/C11H23N3O2/c1-11(2,10(12)13-16)5-7-14-6-3-4-9(15)8-14/h9,15-16H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | QYXBJGAEVPWGQF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide?
The IUPAC name of N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide (CID 77061932) is N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide.
What is the SMILES notation for N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide?
The canonical SMILES for N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide is CC(C)(CCN1CCCC(O)C1)C(N)=NO.
What is the InChIKey of N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide?
The InChIKey is QYXBJGAEVPWGQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2/c1-11(2,10(12)13-16)5-7-14-6-3-4-9(15)8-14/h9,15-16H,3-8H2,1-2H3,(H2,12,13).
What are the key properties of N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide?
N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide has a molecular weight of 229.32 g/mol, XLogP of 0.61, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-4-(3-hydroxypiperidin-1-yl)-2,2-dimethylbutanimidamide is sourced from PubChem (CID 77061932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).