C14H27N3O — CID 77061941
4-[bis(cyclopropylmethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77061941) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[bis(cyclopropylmethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[bis(cyclopropylmethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77061941 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 4-[bis(cyclopropylmethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCN(CC1CC1)CC1CC1)C(N)=NO |
| InChI | InChI=1S/C14H27N3O/c1-14(2,13(15)16-18)7-8-17(9-11-3-4-11)10-12-5-6-12/h11-12,18H,3-10H2,1-2H3,(H2,15,16) |
| InChIKey | FWISGDCBGBWSAC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|