About 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide
4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062113) has the molecular formula C12H27N3O2
and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| PubChem CID | 77062113 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CCCCN(CCO)CCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C12H27N3O2/c1-4-5-7-15(9-10-16)8-6-12(2,3)11(13)14-17/h16-17H,4-10H2,1-3H3,(H2,13,14) |
| InChIKey | VYRQYKFCTPKRGH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
The IUPAC name of 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (CID 77062113) is 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide is CCCCN(CCO)CCC(C)(C)C(N)=NO.
What is the InChIKey of 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
The InChIKey is VYRQYKFCTPKRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3O2/c1-4-5-7-15(9-10-16)8-6-12(2,3)11(13)14-17/h16-17H,4-10H2,1-3H3,(H2,13,14).
What are the key properties of 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide has a molecular weight of 245.37 g/mol, XLogP of 1.24, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butyl(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide is sourced from PubChem (CID 77062113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).