C11H23N3O3S — CID 77062138
4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062138) has the molecular formula C11H23N3O3S and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 77062138 |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCNC1CCS(=O)(=O)CC1)C(N)=NO |
| InChI | InChI=1S/C11H23N3O3S/c1-11(2,10(12)14-15)5-6-13-9-3-7-18(16,17)8-4-9/h9,13,15H,3-8H2,1-2H3,(H2,12,14) |
| InChIKey | XBPLEHOLZXSAMD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|