C9H16N4O2S — CID 77062397
N'-hydroxy-2,2-dimethyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanimidamide (PubChem CID 77062397) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanimidamide |
|---|---|
| PubChem CID | 77062397 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]butanimidamide |
| SMILES | Cc1nnc(SCCC(C)(C)C(N)=NO)o1 |
| InChI | InChI=1S/C9H16N4O2S/c1-6-11-12-8(15-6)16-5-4-9(2,3)7(10)13-14/h14H,4-5H2,1-3H3,(H2,10,13) |
| InChIKey | SHSGDHJRFPRPMN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|