C12H15Cl3N2O2 — CID 77062598
N'-hydroxy-2,2-dimethyl-4-(2,4,5-trichlorophenoxy)butanimidamide (PubChem CID 77062598) has the molecular formula C12H15Cl3N2O2 and a molecular weight of 325.62 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-4-(2,4,5-trichlorophenoxy)butanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-4-(2,4,5-trichlorophenoxy)butanimidamide |
|---|---|
| PubChem CID | 77062598 |
| Molecular Formula | C12H15Cl3N2O2 |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-4-(2,4,5-trichlorophenoxy)butanimidamide |
| SMILES | CC(C)(CCOc1cc(Cl)c(Cl)cc1Cl)C(N)=NO |
| InChI | InChI=1S/C12H15Cl3N2O2/c1-12(2,11(16)17-18)3-4-19-10-6-8(14)7(13)5-9(10)15/h5-6,18H,3-4H2,1-2H3,(H2,16,17) |
| InChIKey | CUYKZJRUUPWEFH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|