About N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide
N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide (PubChem CID 77062633) has the molecular formula C11H25N3O2
and a molecular weight of 231.34 g/mol. Its IUPAC name is N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide |
| PubChem CID | 77062633 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide |
| SMILES | COCCC(C)NCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C11H25N3O2/c1-9(5-8-16-4)13-7-6-11(2,3)10(12)14-15/h9,13,15H,5-8H2,1-4H3,(H2,12,14) |
| InChIKey | APNYMBUGKLSJLL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide?
The IUPAC name of N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide (CID 77062633) is N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide.
What is the SMILES notation for N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide?
The canonical SMILES for N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide is COCCC(C)NCCC(C)(C)C(N)=NO.
What is the InChIKey of N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide?
The InChIKey is APNYMBUGKLSJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O2/c1-9(5-8-16-4)13-7-6-11(2,3)10(12)14-15/h9,13,15H,5-8H2,1-4H3,(H2,12,14).
What are the key properties of N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide?
N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide has a molecular weight of 231.34 g/mol, XLogP of 1.16, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-4-(4-methoxybutan-2-ylamino)-2,2-dimethylbutanimidamide is sourced from PubChem (CID 77062633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).