About 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide
4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062702) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide |
| PubChem CID | 77062702 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCOC1CCCCC1)C(N)=NO |
| InChI | InChI=1S/C12H24N2O2/c1-12(2,11(13)14-15)8-9-16-10-6-4-3-5-7-10/h10,15H,3-9H2,1-2H3,(H2,13,14) |
| InChIKey | ZGWQPRTWFWUOIJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide?
The IUPAC name of 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide (CID 77062702) is 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide is CC(C)(CCOC1CCCCC1)C(N)=NO.
What is the InChIKey of 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide?
The InChIKey is ZGWQPRTWFWUOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-12(2,11(13)14-15)8-9-16-10-6-4-3-5-7-10/h10,15H,3-9H2,1-2H3,(H2,13,14).
What are the key properties of 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide?
4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide has a molecular weight of 228.34 g/mol, XLogP of 2.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyloxy-N'-hydroxy-2,2-dimethylbutanimidamide is sourced from PubChem (CID 77062702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).