About 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide
4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 77062913) has the molecular formula C10H23N3O3
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| PubChem CID | 77062913 |
| Molecular Formula | C10H23N3O3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CC(C)(CCN(CCO)CCO)C(N)=NO |
| InChI | InChI=1S/C10H23N3O3/c1-10(2,9(11)12-16)3-4-13(5-7-14)6-8-15/h14-16H,3-8H2,1-2H3,(H2,11,12) |
| InChIKey | WXEIICKMIVKOTO-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
The IUPAC name of 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide (CID 77062913) is 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide is CC(C)(CCN(CCO)CCO)C(N)=NO.
What is the InChIKey of 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
The InChIKey is WXEIICKMIVKOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O3/c1-10(2,9(11)12-16)3-4-13(5-7-14)6-8-15/h14-16H,3-8H2,1-2H3,(H2,11,12).
What are the key properties of 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide?
4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide has a molecular weight of 233.31 g/mol, XLogP of -0.56, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(2-hydroxyethyl)amino]-N'-hydroxy-2,2-dimethylbutanimidamide is sourced from PubChem (CID 77062913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).