C13H18BrF2N3O — CID 77063638
5-(2-bromo-4,6-difluoroanilino)-N'-hydroxy-2,2-dimethylpentanimidamide (PubChem CID 77063638) has the molecular formula C13H18BrF2N3O and a molecular weight of 350.21 g/mol. Its IUPAC name is 5-(2-bromo-4,6-difluoroanilino)-N'-hydroxy-2,2-dimethylpentanimidamide.
| Compound Name | 5-(2-bromo-4,6-difluoroanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 77063638 |
| Molecular Formula | C13H18BrF2N3O |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 5-(2-bromo-4,6-difluoroanilino)-N'-hydroxy-2,2-dimethylpentanimidamide |
| SMILES | CC(C)(CCCNc1c(F)cc(F)cc1Br)C(N)=NO |
| InChI | InChI=1S/C13H18BrF2N3O/c1-13(2,12(17)19-20)4-3-5-18-11-9(14)6-8(15)7-10(11)16/h6-7,18,20H,3-5H2,1-2H3,(H2,17,19) |
| InChIKey | LNYFKKQNYGKJJS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|