C17H27N3O — CID 77064506
3-(4,4-dimethylazepan-1-yl)-N'-hydroxy-3-phenylpropanimidamide (PubChem CID 77064506) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-(4,4-dimethylazepan-1-yl)-N'-hydroxy-3-phenylpropanimidamide.
| Compound Name | 3-(4,4-dimethylazepan-1-yl)-N'-hydroxy-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 77064506 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 3-(4,4-dimethylazepan-1-yl)-N'-hydroxy-3-phenylpropanimidamide |
| SMILES | CC1(C)CCCN(C(CC(N)=NO)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H27N3O/c1-17(2)9-6-11-20(12-10-17)15(13-16(18)19-21)14-7-4-3-5-8-14/h3-5,7-8,15,21H,6,9-13H2,1-2H3,(H2,18,19) |
| InChIKey | FYPSXKARWIULLJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|