About 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione
1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 77064669) has the molecular formula C10H14ClNO2
and a molecular weight of 215.68 g/mol. Its IUPAC name is 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione |
| PubChem CID | 77064669 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(=O)N(CC=CCCl)C1=O |
| InChI | InChI=1S/C10H14ClNO2/c1-10(2)7-8(13)12(9(10)14)6-4-3-5-11/h3-4H,5-7H2,1-2H3 |
| InChIKey | DJCBBFFYWJXLLB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione?
The IUPAC name of 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione (CID 77064669) is 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione.
What is the SMILES notation for 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione?
The canonical SMILES for 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione is CC1(C)CC(=O)N(CC=CCCl)C1=O.
What is the InChIKey of 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione?
The InChIKey is DJCBBFFYWJXLLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO2/c1-10(2)7-8(13)12(9(10)14)6-4-3-5-11/h3-4H,5-7H2,1-2H3.
What are the key properties of 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione?
1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione has a molecular weight of 215.68 g/mol, XLogP of 1.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorobut-2-enyl)-3,3-dimethylpyrrolidine-2,5-dione is sourced from PubChem (CID 77064669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).