C15H19NO4 — CID 77064809
3-[3-(2-ethoxyethylcarbamoyl)-4-methylphenyl]prop-2-enoic acid (PubChem CID 77064809) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[3-(2-ethoxyethylcarbamoyl)-4-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(2-ethoxyethylcarbamoyl)-4-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77064809 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-[3-(2-ethoxyethylcarbamoyl)-4-methylphenyl]prop-2-enoic acid |
| SMILES | CCOCCNC(=O)c1cc(C=CC(=O)O)ccc1C |
| InChI | InChI=1S/C15H19NO4/c1-3-20-9-8-16-15(19)13-10-12(5-4-11(13)2)6-7-14(17)18/h4-7,10H,3,8-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | DBXYQQNSJHZXAX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|