C16H25N3O2 — CID 77065974
N'-hydroxy-2-methoxy-5-[[(1-methylcyclohexyl)amino]methyl]benzenecarboximidamide (PubChem CID 77065974) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is N'-hydroxy-2-methoxy-5-[[(1-methylcyclohexyl)amino]methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-2-methoxy-5-[[(1-methylcyclohexyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77065974 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N'-hydroxy-2-methoxy-5-[[(1-methylcyclohexyl)amino]methyl]benzenecarboximidamide |
| SMILES | COc1ccc(CNC2(C)CCCCC2)cc1C(N)=NO |
| InChI | InChI=1S/C16H25N3O2/c1-16(8-4-3-5-9-16)18-11-12-6-7-14(21-2)13(10-12)15(17)19-20/h6-7,10,18,20H,3-5,8-9,11H2,1-2H3,(H2,17,19) |
| InChIKey | RGXUUGVQUGBVKG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|