C11H9N5 — CID 77068234
N-pyridin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 77068234) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is N-pyridin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-pyridin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 77068234 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | N-pyridin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | c1cncc(Nc2ncnn3cccc23)c1 |
| InChI | InChI=1S/C11H9N5/c1-3-9(7-12-5-1)15-11-10-4-2-6-16(10)14-8-13-11/h1-8H,(H,13,14,15) |
| InChIKey | KTWGHBNFKBORPM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |