C17H13N5 — CID 77068235
6-phenyl-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 77068235) has the molecular formula C17H13N5 and a molecular weight of 287.33 g/mol. Its IUPAC name is 6-phenyl-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 6-phenyl-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 77068235 |
| Molecular Formula | C17H13N5 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 6-phenyl-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | c1ccc(-c2cc3c(Nc4ccncc4)ncnn3c2)cc1 |
| InChI | InChI=1S/C17H13N5/c1-2-4-13(5-3-1)14-10-16-17(19-12-20-22(16)11-14)21-15-6-8-18-9-7-15/h1-12H,(H,18,19,20,21) |
| InChIKey | KOECVTWSFPGZJE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |