About 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid
3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid (PubChem CID 77070016) has the molecular formula C16H12Cl2O2S
and a molecular weight of 339.24 g/mol. Its IUPAC name is 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid |
| PubChem CID | 77070016 |
| Molecular Formula | C16H12Cl2O2S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CSc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H12Cl2O2S/c17-14-7-6-13(9-15(14)18)21-10-12-3-1-11(2-4-12)5-8-16(19)20/h1-9H,10H2,(H,19,20) |
| InChIKey | DILFBXMHXLALMX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid?
The IUPAC name of 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid (CID 77070016) is 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid.
What is the SMILES notation for 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid?
The canonical SMILES for 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid is O=C(O)C=Cc1ccc(CSc2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid?
The InChIKey is DILFBXMHXLALMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2O2S/c17-14-7-6-13(9-15(14)18)21-10-12-3-1-11(2-4-12)5-8-16(19)20/h1-9H,10H2,(H,19,20).
What are the key properties of 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid?
3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid has a molecular weight of 339.24 g/mol, XLogP of 5.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(3,4-dichlorophenyl)sulfanylmethyl]phenyl]prop-2-enoic acid is sourced from PubChem (CID 77070016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).