C11H18N6O — CID 77070723
2-[1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77070723) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 2-[1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77070723 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CN2CCn3cnnc3C2)CC1)=NO |
| InChI | InChI=1S/C11H18N6O/c12-9(15-18)5-11(1-2-11)7-16-3-4-17-8-13-14-10(17)6-16/h8,18H,1-7H2,(H2,12,15) |
| InChIKey | HVIMZBRKMUVMDG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|