About 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide
2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77070769) has the molecular formula C11H21N3O3
and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| PubChem CID | 77070769 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | NC(CC1(CNCC2COCCO2)CC1)=NO |
| InChI | InChI=1S/C11H21N3O3/c12-10(14-15)5-11(1-2-11)8-13-6-9-7-16-3-4-17-9/h9,13,15H,1-8H2,(H2,12,14) |
| InChIKey | GKDIRQBHDQNSEP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide (CID 77070769) is 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide is NC(CC1(CNCC2COCCO2)CC1)=NO.
What is the InChIKey of 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
The InChIKey is GKDIRQBHDQNSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O3/c12-10(14-15)5-11(1-2-11)8-13-6-9-7-16-3-4-17-9/h9,13,15H,1-8H2,(H2,12,14).
What are the key properties of 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide?
2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide has a molecular weight of 243.31 g/mol, XLogP of -0.09, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1,4-dioxan-2-ylmethylamino)methyl]cyclopropyl]-N'-hydroxyethanimidamide is sourced from PubChem (CID 77070769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).