C16H23N3O — CID 77071115
N'-hydroxy-2-[1-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]cyclopropyl]ethanimidamide (PubChem CID 77071115) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N'-hydroxy-2-[1-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]cyclopropyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[1-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]cyclopropyl]ethanimidamide |
|---|---|
| PubChem CID | 77071115 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N'-hydroxy-2-[1-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]cyclopropyl]ethanimidamide |
| SMILES | NC(CC1(CNC2CCCc3ccccc32)CC1)=NO |
| InChI | InChI=1S/C16H23N3O/c17-15(19-20)10-16(8-9-16)11-18-14-7-3-5-12-4-1-2-6-13(12)14/h1-2,4,6,14,18,20H,3,5,7-11H2,(H2,17,19) |
| InChIKey | WZZQUXUIDFPVLA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|